Diacerein
Diacerein is a symptomatic slow-acting medicine in osteoarthritis which can reduce the level of IL-1 receptors leading to fewer receptors to form heterodimer complexes.
| Trivial name | SF 277 |
| Catalog Number | CSN16710 |
| Alternative Name(s) | SF 277 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C19H12O8 |
| CAS# | 13739-02-1 |
| Purity | ≥99% |
| SMILES | O=C(C1=C2C(OC(C)=O)=CC=C1)C3=CC(C(O)=O)=CC(OC(C)=O)=C3C2=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/diacerein.html |