GSK J4 free base
histone demethylase JMJD3/UTX inhibitor Chromatin/Epigenetics|Histone Demethylases
| Catalog Number | B5959-50 |
| Research Area | Chromatin/Epigenetics|Histone Demethylases |
| Molecular Formula | C24H27N5O2 |
| CAS# | 1373423-53-0 |
| Purity | 98% |
| SMILES | CCOC(CCNC1=CC(N2CCC3=CC=CC=C3CC2)=NC(C4=CC=CC=N4)=N1)=O |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B5959 |
