Pemetrexed
Pemetrexed (LY231514) is a novel antifolate and antimetabolite for thymidylate synthase (TS), dihydrofolate reductase (DHFR) and glycinamide ribonucleotide formyltransferase (GARFT) with Ki of 1.3 nM, 7.2 nM and 65 nM in cell-free assays, respectively. Pemetrexed induces autophagy and apoptosis.
| Trivial name | LY231514 |
| Catalog Number | S5971 |
| Molecular Formula | C20H21N5O6 |
| CAS# | 137281-23-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | NC1=NC(=O)C2=C([NH]C=C2CCC3=CC=C(C=C3)C(=O)NC(CCC(O)=O)C(O)=O)N1 |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/pemetrexed.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5971-pemetrexed-chemical-structure.gif |