Pemetrexed
Pemetrexed is an antifolate and antimetabolite for TS(thymidylate synthase), DHFR(dihydrofolate reductase) and GARFT(glycinamide ribonucleotide formyltransferase) with Ki of 1.3 nM, 7.2 nM and 65 nM, respectively.
| Trivial name | LY-231514 |
| Catalog Number | CSN11667 |
| Alternative Name(s) | LY-231514 |
| Research Area | Cancer |
| Molecular Formula | C20H21N5O6 |
| CAS# | 137281-23-3 |
| Purity | ≥99% |
| SMILES | O=C([C@H](CCC(O)=O)NC(C1=CC=C(C=C1)CCC2=CNC(NC(N)=N3)=C2C3=O)=O)O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/pemetrexed.html |