Pimecrolimus
Pimecrolimus, a calcineurin inhibitor immunosuppressant, binds to the receptor macrophilin-12 (FKBP-12) forming a complex that blocks the calcium-dependent signal transduction cascade mediated by calcineurin.
| Catalog Number | T2648 |
| Alternative Name(s) | SDZ-ASM 981 , ASM 981 |
| Research Area | Others |
| Molecular Formula | C43H68ClNO11 |
| CAS# | 137071-32-0 |
| SMILES | CC[C@@H]1\C=C(C)\C[C@H](C)C[C@H](OC)[C@H]2O[C@](O)([C@H](C)C[C@@H]2OC)C(=O)C(=O)N2CCCC[C@H]2C(=O)O[C@@H]([C@H](C)[C@@H](O)CC1=O)C(\C)=C\[C@@H]1CC[C@H](Cl)[C@@H](C1)OC |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/Pimecrolimus |
| Additional Information | https://www.targetmol.com/datasheet/T2648 |