Ciliobrevin D
Ciliobrevin D (compound 5) is a cell-permeable, reversible and specific antagonist of AAA+ (ATPases associated with diverse cellular activities) ATPase motor cytoplasmic dynein. Ciliobrevin D perturbs primary cilia formation and blocks Hedgehog (Hh) signaling.
Trivial name | N/A |
Catalog Number | S9743 |
Molecular Formula | C17H8Cl3N3O2 |
CAS# | 1370554-01-0 |
SMILES | ClC1=CC(=C(C=C1)C(=O)C(\C#N)=C2/NC(=O)C3=CC=C(Cl)C=C3N2)Cl |
Size | 5mg |
Supplier Page | http://www.selleckchem.com/products/ciliobrevin-d.html |
Additional Information | https://file.selleck.cn/downloads/struct/s9743-ciliobrevin-d-chemical-structure.gif |