P505-15 10mM * 1mL in DMSO
P505-15 (also known as PRT062607) is a novel, highly selective, and orally bioavailable small molecule SYK inhibitor (SYK IC(50) = 1 nM) with anti-SYK activity that is at least 80-fold greater than its affinity for other kinases.
| Trivial name | P505-15 10mM * 1mL in DMSO |
| Catalog Number | A11952-10mM-D |
| Alternative Name(s) | 4-(3-(2H-1,2,3-triazol-2-yl)phenylamino)-2-((1R,2S)-2-aminocyclohexylamino) pyrimidine-5-carboxamide |
| Molecular Formula | C19H23N9O |
| CAS# | 1370261-96-3 |
| SMILES | CC(=O)O.C1CC[C@H]([C@H](C1)N)NC2=NC=C(C(=N2)NC3=CC=CC(=C3)N4N=CC=N4)C(=O)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/p505-15.html |