5-Formyl-dC
5-Formyl-dC, an indispensable reagent in the biomedicine field, occupies a pivotal position owing to its unparalleled characteristics. Its significance lies in facilitating the synthesis of tailored nucleic acids, thereby facilitating in-depth exploration of various research domains. Remarkably, this compound imparts unprecedented opportunities for the discovery of novel therapeutic agents and diagnostic instruments targeting a broad spectrum of ailments spanning cancer and hereditary anomalies.
Catalog Number | PIPB-0363 |
Alternative Name(s) | Cytidine, 2'-deoxy-5-formyl- 2'-Deoxy-5-formylcytidine 5-formyl-dC 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidine-5-carbaldehyde |
Research Area | Phosphoramidites Series |
Molecular Formula | C10H13N3O5 |
CAS# | 137017-45-9 |
SMILES | C1C(C(OC1N2C=C(C(=NC2=O)N)C=O)CO)O |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/5-formyl-dc-item-10481.html |