D-Pantothenic Acid Hemicalcium
D-Pantothenic acid hemicalcium salt, a kind of water soluble vitamin, is a water-soluble vitamin and an essential nutrient for many animals.
| Trivial name | D-Pantothenic Acid Calcium; Calcium D-Pantothenate; Vitamin-B5 Calcium Salt; Calcium Pantothenate |
| Catalog Number | CSN16157 |
| Alternative Name(s) | D-Pantothenic Acid Calcium; Calcium D-Pantothenate; Vitamin-B5 Calcium Salt; Calcium Pantothenate |
| Research Area | / |
| Molecular Formula | C18H32CaN2O10 |
| CAS# | 137-08-6 |
| Purity | ≥98% |
| SMILES | O=C([O-])CCNC([C@H](O)C(C)(C)CO)=O.O=C([O-])CCNC([C@H](O)C(C)(C)CO)=O.[Ca+2] |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/d-pantothenic-acid-hemicalcium.html |
