Lubiprostone 2mg
Lubiprostone is a bicyclic fatty acid metabolite analog of Prostaglandin E1. It activates specific chloride channels in the gastrointestinal tract to stimulate intestinal fluid secretion, and increase gastrointestinal transit.
Trivial name | Lubiprostone 2mg |
Catalog Number | A10540-2 |
Alternative Name(s) | 7-[(1R,4R,6R,9R)-4-(1,1-Difluoropentyl)-4-hydroxy-8-oxo-5-oxabicyclo[4.3.0]non-9-yl]heptanoic acid |
Molecular Formula | C20H32F2O5 |
CAS# | 136790-76-6 |
SMILES | CCCCC([C@]1(CC[C@H]2[C@H](O1)CC(=O)[C@@H]2CCCCCCC(=O)O)O)(F)F |
Size | 2mg |
Supplier Page | http://www.adooq.com/lubiprostone.html |