Lubiprostone 10mg
Lubiprostone is a bicyclic fatty acid metabolite analog of Prostaglandin E1. It activates specific chloride channels in the gastrointestinal tract to stimulate intestinal fluid secretion, and increase gastrointestinal transit.
| Trivial name | Lubiprostone 10mg |
| Catalog Number | A10540-10 |
| Alternative Name(s) | 7-[(1R,4R,6R,9R)-4-(1,1-Difluoropentyl)-4-hydroxy-8-oxo-5-oxabicyclo[4.3.0]non-9-yl]heptanoic acid |
| Molecular Formula | C20H32F2O5 |
| CAS# | 136790-76-6 |
| SMILES | CCCCC([C@]1(CC[C@H]2[C@H](O1)CC(=O)[C@@H]2CCCCCCC(=O)O)O)(F)F |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/lubiprostone.html |