4′-epi-Entecavir
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-15227 |
| Alternative Name(s) | 2-amino-9-((1S,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl)-1H-purin-6(9H)-one; Entecavir Isomer 2; Entecavir impurity D; CS-T-21664; 1S,3R,4R Entecavir |
| Research Area | Impurity in commercial preparation of Entecavir. It is an epimeric impurity of the antiviral drug Entecavir. |
| Molecular Formula | C12H15N5O3 |
| CAS# | 1367369-80-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C=C([C@@H]1CO)[C@H](C[C@H]1O)N2C(NC(N)=NC3=O)=C3N=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15227.html |
| Additional Information | NULL |