1-epi-Entecavir
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-14795 |
| Alternative Name(s) | Entecavir EP Impurity A; 2-Amino-1,9-dihydro-9-[(1R,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl]-6H-purin-6-one; Entecavir Isomer Impurity 3; (1R,3R,4S)-Entecavir Isomer |
| Research Area | Impurity in commercial preparation of Entecavir. An epimeric impurity of the antiviral drug Entecavir. |
| Molecular Formula | C12H15N5O4 |
| CAS# | 1367369-78-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C=C([C@@H]1CO)[C@@H](C[C@@H]1O)N2C(NC(N)=NC3=O)=C3N=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14795.html |
| Additional Information | NULL |