(1R,3R,4R)-Entecavir
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-21665 |
| Alternative Name(s) | 2-Amino-1,9-dihydro-9-[(1R,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylpurin-6-one |
| Research Area | (1R,3R,4R)-Entecavir is an isomeric impurity of Entecavir.;Impurity in commercial preparations of Entecavir |
| Molecular Formula | C12H15N5O3 |
| CAS# | 1367369-76-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C=C([C@@H]1CO)[C@@H](C[C@H]1O)N2C(NC(N)=NC3=O)=C3N=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST21665.html |
| Additional Information | NULL |