α,α-Trehalose 6-phosphate potassium | MedChemExpress (MCE)
α,α-Trehalose 6-phosphate (Tre6P) potassium is an endogenous metabolite. α,α-Trehalose 6-phosphate is a 6-phosphate derivative of α,α′-trehalose. α,α-Trehalose 6-phosphate is rapidly converted to the pathway end product, α,α′-trehalose, through the action of Tre6P phosphatase (T6PP)[1].
| Trivial name | α,α-Trehalose 6-phosphate potassium |
| Catalog Number | HY-131368 |
| Alternative Name(s) | Tre6P potassium |
| Research Area | Others |
| CAS# | 136632-28-5 |
| Purity | ≥98.00% |
| SMILES | O=P(O[K])(O[K])OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO |
| PubChem Chemical Structure ID | 168679787 |
| Size | 2500 μg |
| Supplier Page | https://www.medchemexpress.com/α-α-trehalose-6-phosphate-potassium.html |