BQ-123
Selective ETA receptor antagonist GPCR/G protein|ETA Receptors
| Catalog Number | B6626-10 |
| Research Area | GPCR/G protein|ETA Receptors |
| Molecular Formula | C31H42N6O7 |
| CAS# | 136553-81-6 |
| Purity | 98% |
| SMILES | O=C([C@H]1N(C([C@H](CC(O)=O)NC([C@H](CC2=CNC3=CC=CC=C23)NC4=O)=O)=O)CCC1)N[C@@H](C(N[C@H]4CC(C)C)=O)C(C)C |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6626 |
