Duloxetine HCl 10mM * 1mL in DMSO
Duloxetine Hydrochloride is a dual serotonin and norepinephrine reuptake inhibitor (SNRI) that is used in the treatment of stress urinary incontinence, as well as depression.
| Trivial name | Duloxetine HCl 10mM * 1mL in DMSO |
| Catalog Number | A11717-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C18H19NOS.HCl |
| CAS# | 136434-34-9 |
| SMILES | CNCC[C@@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/duloxetine-hcl.html |