Fendiline hydrochloride
Fendiline hydrochloride is the hydrochloride salt form of Fendiline, which is an L-type calcium channel blocker and also a specific inhibitor of K-Ras plasma membrane targeting with no detectable effect on the localization of H- and N-Ras.
| Trivial name | N/A |
| Catalog Number | S5279 |
| Molecular Formula | C27H22O12 |
| CAS# | 13636-18-5 |
| Inchi | InChI=1S/C27H22O12/c28-15-5-1-12(9-18(15)31)10-20(26(34)35)38-21(33)8-4-13-2-7-17(30)25-22(13)23(27(36)37)24(39-25)14-3-6-16(29)19(32)11-14/h1-9,11,20,23-24,28-32H,10H2,(H,34,35)(H,36,37)/b8-4+/t20-,2 3+,24-/m1/s1 |
| Inchi Key | UJZQBMQZMKFSRV-RGKBJLTCSA-N |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=C3C(C(OC3=C(C=C2)O)C4=CC(=C(C=C4)O)O)C(=O)O)O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/fendiline-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/fendiline-hydrochloride-chemical-structure-s5279.gif |
