Rasagiline
API Standard
| Catalog Number | CS-O-11733 |
| Alternative Name(s) | (R)-N-(prop-2-yn-1-yl)-2,3-dihydro-1H-inden-1-amine |
| Research Area | Rasagiline, is a selective and irreversible propargylamine inhibitor of monoamine oxidase which has been used to increase the availability of dopamine at striatal receptors as a method to treat Parkinson's disease. |
| Molecular Formula | C12H13N |
| CAS# | 136236-51-6 |
| Purity | >98% |
| SMILES | C#CCN[C@H]1C(C=CC=C2)=C2CC1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11733.html |