Cyanine3 carboxylic acid | MedChemExpress (MCE)
Cyanine3 carboxylic acid belongs to the cyanine dye series and is a common fluorescent marker for biomolecules that can interact with biomolecules. Cyanine dyes may also bind to double-helical DNA through intercalation and exhibit enhanced fluorescence upon binding.
Trivial name | Cyanine3 carboxylic acid |
Catalog Number | HY-D1326 |
CAS# | 1361402-15-4 |
Purity | ≥98.0% |
SMILES | O=C(CCCCCN1C2=C(C(C)(C)/C1=C\C=C\C3=[N+](C)C4=C(C3(C)C)C=CC=C4)C=CC=C2)[O-] |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/cyanine3-carboxylic-acid.html |