Minocycline HCl
Minocycline HCl is the most lipid soluble and most active tetracycline antibiotic, binds to the 30S ribosomal subunit, preventing the binding of tRNA to the mRNA-ribosome complex and interfering with protein synthesis.
| Trivial name | CL 59806 |
| Catalog Number | S4226 |
| Molecular Formula | C23H27N3O7.HCl |
| CAS# | 13614-98-7 |
| Inchi | InChI=1S/C23H27N3O7.ClH/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28;/h5-6,9,11,17,27,29-30,33H,7-8H2,1-4H3,(H2,24,32);1H/t9-,11-,17-,23-;/m0./ s1 |
| Inchi Key | GLMUAFMGXXHGLU-VQAITOIOSA-N |
| SMILES | CN(C)C1C2CC3CC4=C(C=CC(=C4C(=C3C(=O)C2(C(=C(C1=O)C(=O)N)O)O)O)O)N(C)C.Cl |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/minocycline-hcl.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4226-minocycline-cl-59806-hcl-chemical-structure.png |