Hydrocortisone 17-butyrate (Standard) | MedChemExpress (MCE)
Hydrocortisone 17-butyrate (Standard) is the analytical standard of Hydrocortisone 17-butyrate. This product is intended for research and analytical applications. Hydrocortisone 17-butyrate is an adrenocortical hormone active molecule.
| Trivial name | Hydrocortisone 17-butyrate (Standard) |
| Catalog Number | HY-B0983R |
| Alternative Name(s) | Cortisol 17-butyrate (Standard); Hydrocortisone butyrate (Standard) |
| Research Area | Inflammation/Immunology; Endocrinology |
| CAS# | 13609-67-1 |
| Purity | ≥98.0% |
| SMILES | C[C@@]12[C@](C(CO)=O)(OC(CCC)=O)CC[C@@]1([H])[C@]3([H])CCC4=CC(CC[C@]4(C)[C@@]3([H])[C@@H](O)C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/hydrocortisone-17-butyrate-standard.html |