BP-M345 | MedChemExpress (MCE)
BP-M345 (compound 5) is a potent, cancer cell-targeting antiproliferative agent that exhibits low toxicity to non-tumor cells. BP-M345 inhibits cancer cell proliferation with a GI50 value ranging from 0.17 to 0.45 μM[1].
| Trivial name | BP-M345 |
| Catalog Number | HY-157850 |
| Research Area | Cancer |
| CAS# | 1360119-00-1 |
| Purity | ≥98.0% |
| SMILES | COC1=CC(/C=C2COC/C(C\2=O)=C\C3=CC(OC)=C(C(OC)=C3)OC)=CC(OC)=C1OC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bp-m345.html |