AVL-292 benzenesulfonate 10mg
AVL-292 benzenesulfonate is a covalent, highly selective, orally active small molecule inhibitor of Btk with IC50 value of 0.5 nM, >1400-fold selectivity over the other kinases assayed.
| Trivial name | AVL-292 benzenesulfonate 10mg |
| Catalog Number | A15008-10 |
| Alternative Name(s) | 7-((10,11-Dihydro-5H-dibenzo(a,d)cyclohepten-5-yl)amino)heptanoic acid |
| Molecular Formula | C28H28FN5O6S |
| CAS# | 1360053-81-1 |
| SMILES | COCCOC1=CC=C(C=C1)NC2=NC=C(C(=N2)NC3=CC(=CC=C3)NC(=O)C=C)F.C1=CC=C(C=C1)S(=O)(=O)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/avl-292-benzenesulfonate.html |
