OG-L002 10mM * 1mL in DMSO
OG-L002 is a potent and specific LSD1 inhibitor with IC50 of 20 nM, exhibiting 36- and 69-fold selectivity over MAO-B and MAO-A, respectively.
| Trivial name | OG-L002 10mM * 1mL in DMSO |
| Catalog Number | A13246-10mM-D |
| Alternative Name(s) | 4'-((trans)-2-aminocyclopropyl)biphenyl-3-ol hydrochloride |
| Molecular Formula | C15H15NO.HCl |
| CAS# | 1357302-64-7 |
| SMILES | CCOc1cc(ccc1Nc1ncc2c(n1)n(C)c1ccccc1c(=O)n2C)N1CCC(CC1)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/og-l002.html |