ML 228 50mg
ML-228 is an activator of the HIF signaling pathway, as demonstrated by HIF response element (HRE) reporter assay, HIF-1?? nuclear translocation assay, and increased VEGF expression.
| Trivial name | ML 228 50mg |
| Catalog Number | A15360-50 |
| Alternative Name(s) | N-([1,1'-biphenyl]-4-ylmethyl)-6-phenyl-3-(pyridin-2-yl)-1,2,4-triazin-5-amine |
| Molecular Formula | C27H21N5 |
| CAS# | 1357171-62-0 |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CNC3=C(N=NC(=N3)C4=CC=CC=N4)C5=CC=CC=C5 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/ml-228.html |
