Perindopril D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02626 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Perindopril, intended for use as an internal standard for the quantification of Perindopril by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H28N2O5D4 |
| CAS# | 1356929-58-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1[C@](CCCC2)([H])[C@]2([H])C[C@H]1C(O)=O)[C@@](C([2H])([2H])[2H])([2H])N[C@@H](CCC)C(OCC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02626.html |
| Additional Information | NULL |