Tacrolimus 13CD2
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03122 |
| Alternative Name(s) | Advagraf3C,D2; Prograf-13C,D2; Protopic-13C,D2; TacroBell-13C,D2; Tacrolimus-13C,D2; Tsukubaenolide-13C,D2. |
| Research Area | Labeled Tacrolimus, intended for use as an internal standard for the quantification of Tacrolimus by GC- or LC-mass spectrometry. |
| Molecular Formula | C4313CH67D2NO12 |
| CAS# | 1356841-89-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CO[C@@H]1[C@]([C@H](C[C@H](C/C(C)=C[C@@](C(C[C@H](O)[C@H]2C)=O)([H])C/C=[13C]([2H])[2H])C)OC)([H])O[C@@](O)(C(C(N(CCCC3)[C@]3([H])C(O[C@@H]2/C(C)=C/[C@H](CC[C@H]4O)C[C@H]4OC)=O)=O)=O)[C@H](C)C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03122.html |
| Additional Information | NULL |
