Quinapril D5 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10074 |
| Alternative Name(s) | (3S)-2-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4- (H5)phenylbutan-2-yl]amino}propanoyl]-1,2,3,4- tetrahydroisoquinoline-3carboxylc cid hydrchloride |
| Research Area | A deuterium-labeled salt of quinapril. Quinapril-d5, Hydrochloride is deuterium-labeled Quinapril. Quinapril-d5, Hydrochloride acts as an angiotensin converting enzyme (ACE) inhibitor. This compound has potential to be used in kinetic isotope studies and ;Labeled Quinapril, intended for use as an internal standard for the quantification of Quinapril by GC- or LC-mass spectrometry. |
| Molecular Formula | C25H26DClN2O5 |
| CAS# | 1356020-03-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(CC1=CC=CC=C1C2)[C@@H]2C(O)=O)[C@H](C)N[C@H](C(OCC)=O)CCC(C([2H])=C3[2H])=C(C([2H])=C3[2H])[2H].Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10074.html |
| Additional Information | NULL |