Leniolisib phosphate | MedChemExpress (MCE)
Leniolisib (CDZ173) phosphate is a potent and selective PI3Kδ inhibitor. Leniolisib phosphate has the potential for immunodeficiency disorders treatment.
| Trivial name | Leniolisib phosphate |
| Catalog Number | HY-17635A |
| Alternative Name(s) | CDZ173 phosphate |
| Research Area | Inflammation/Immunology |
| CAS# | 1354691-97-6 |
| Purity | 99.10% |
| SMILES | CCC(N1C[C@H](CC1)NC2=C3CN(CCC3=NC=N2)C4=CC(C(F)(F)F)=C(N=C4)OC)=O.O=P(O)(O)O |
| PubChem Chemical Structure ID | 90214495 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/leniolisib-phosphate.html |