Strontium Ranelate
Strontium ranelate stimulates the calcium sensing receptors (CaSR) and leads to the differentiation of pre-osteoblast to osteoblast which increases the bone formation.
| Trivial name | Distrontium Renelate; S12911 |
| Catalog Number | CSN11988 |
| Alternative Name(s) | Distrontium Renelate; S12911 |
| Research Area | Metabolic Disease |
| Molecular Formula | C12H6N2O8SSr2 |
| CAS# | 135459-87-9 |
| Purity | ≥99% |
| SMILES | N#CC1=C(N(CC([O-])=O)CC([O-])=O)SC(C([O-])=O)=C1CC([O-])=O.[Sr+2].[Sr+2] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/strontium-ranelate.html |