Strontium ranelate (Protelos) 50mg
Strontium ranelate is an antiosteoporotic agent which both increases bone formation and reduces bone resorption, resulting in a rebalance of bone turnover in favor of bone formation. This is similar to the effects of choline stabilized orthosilicic acid.
| Trivial name | Strontium ranelate (Protelos) 50mg |
| Catalog Number | A11681-50 |
| Alternative Name(s) | distrontium 5-[bis(2-oxido-2-oxoethyl)amino]-4-cyano- 3-(2-oxido-2-oxoethyl)thiophene-2-carboxylate |
| Molecular Formula | C12H6N2O8S.2Sr |
| CAS# | 135459-87-9 |
| SMILES | C(C1=C(SC(=C1C#N)N(CC(=O)[O-])CC(=O)[O-])C(=O)[O-])C(=O)[O-].[Sr+2].[Sr+2] |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/strontium-ranelate-protelos.html |