EW-7197 10mM * 1mL in DMSO
EW-7197 is a highly potent, selective, and orally bioavailable TGF-?? I receptor ALK4/ALK5 inhibitor with IC50 of 13 nM and 11 nM, respectively
| Trivial name | EW-7197 10mM * 1mL in DMSO |
| Catalog Number | A14213-10mM-D |
| Alternative Name(s) | N-(2-fluorophenyl)-5-(6-methyl-2-pyridinyl)-4-[1,2,4]triazolo[1,5-a]pyridin-6-yl-1H-imidazole-2-methanamine |
| Molecular Formula | C22H18FN7 |
| CAS# | 1352608-82-2 |
| SMILES | CC1=CC=CC(=N1)C2=C(N=C(N2)CNC3=CC=CC=C3F)C4=CN5C(=NC=N5)C=C4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ew-7197.html |