Repaglinide
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02235 |
| Alternative Name(s) | (S)-2-ethoxy-4-(2-((3-methyl-1-(2-(piperidin-1-yl)phenyl)butyl)amino)-2-oxoethyl)benzoic acid |
| Research Area | Repaglinide is a nonsulfonylurea insulin secretagogue belonging to the melgitinide class with hypoglycemic activity. Repaglinide is rapidly absorbed and has a rapid onset and short duration of action. This agent is metabolized in the liver by CYP2C8 and C |
| Molecular Formula | C27H36N2O4 |
| CAS# | 135062-02-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(CC1=CC(OCC)=C(C(O)=O)C=C1)N[C@H](C2=C(N3CCCCC3)C=CC=C2)CC(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02235.html |
| Additional Information | NULL |