(±)-Clopidogrel bisulfate | MedChemExpress (MCE)
Clopidogrel sulfate is an antiplatelet agent. Specifically, Clopidogrel sulfate inhibits the binding of ADP to its receptors on the membranes of platelet cells, and blocks ADP-mediated activation of the glycoprotein GPIIb/IIIa complex. Clopidogrel sulfate can be used for research of heart disease and stroke[1].
| Trivial name | (±)-Clopidogrel bisulfate |
| Catalog Number | HY-107867 |
| Research Area | Cardiovascular Disease |
| CAS# | 135046-48-9 |
| Purity | 99.97% |
| SMILES | COC(C(C1=C(C=CC=C1)Cl)N2CC3=C(SC=C3)CC2)=O.O=S(O)(O)=O |
| PubChem Chemical Structure ID | 16757820 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-clopidogrel-bisulfate.html |