XL765 10mM * 1mL in DMSO
XL765 is a PI3K/mTOR dual kinase inhibitor and it is more potent compared to an agent that inhibits either PI3K kinase or mTOR kinase alone.
| Trivial name | XL765 10mM * 1mL in DMSO |
| Catalog Number | A10997-10mM-D |
| Alternative Name(s) | N-[2-[(3,5-Dimethoxyphenyl)amino]quinoxalin-3-yl]-4-[(4-methyl-3-methoxyphenyl)carbonyl]aminophenylsulfonamide |
| Molecular Formula | C31H29N5O6S |
| CAS# | 1349796-36-6 |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=CC=C(C=C2)S(=O)(=O)NC3=NC4=CC=CC=C4N=C3NC5=CC(=CC(=C5)OC)OC)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/xl765.html |
