trans-Hydroxy Praziquantel
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-05817 |
| Alternative Name(s) | trans-Hydroxy Praziquantel;1,2,3,6,7,11b-Hexahydro-2onyl]-4H-pyrazino[2,1-a]isoquinolin-4-one; trans-1,2,3,6,7,11b-Hexahydro-2-[(4-hydcarbonyl]- 4H-pyrazino[2,1-a]isoquinolin-4-one; |
| Research Area | The main trans-monHydroxyydroxylated metabolite of Praziquantel . |
| Molecular Formula | C19H24N2O3 |
| CAS# | 134924-71-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(CN(C([C@H]1CC[C@H](O)CC1)=O)C2)N3C2C(C=CC=C4)=C4CC3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05817.html |
| Additional Information | NULL |