Lamivudine 15N D2 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06703 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Lamivudine, intended for use as an internal standard for the quantification of Lamivudine by GC- or LC-mass spectrometry. |
| Molecular Formula | C8H8D2FN2(15NO3)S.HCl |
| CAS# | 134678-17-4 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[13C]1[15N]([C@H]2O[C@@H](C([2H])([2H])O)SC2)C=CC(N)=[15N]1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06703.html |
| Additional Information | NULL |