Fingolimod D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02993 |
| Alternative Name(s) | 2-Amino-2-(2-(4-ctylphenyl)ethyl)propane-1,3-diol-d4; 2-amino-2-[2-(4-octylphenyl)ethyl](D4)propane-1,3- diol |
| Research Area | Labeled Fingolimod, intended for use as an internal standard for the quantification of Fingolimod by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H29D4NO2 |
| CAS# | 1346747-38-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(C([2H])([2H])O)(C([2H])([2H])O)CCC1=CC=C(CCCCCCCC)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02993.html |
| Additional Information | NULL |