2-Oxo Tadalafil
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-05922 |
| Alternative Name(s) | (6R,12aR)-6-(2-Oxo-1,3-benzodioxol-5-yl)-2,3,6,7,12,12a-hexahydro-2-methylpyrazino ,pyrido[3,4-b]indole-1,4-dione; 2-Keto Tadalafil; |
| Research Area | An impurity of Tadalafil . Impurity in commercial preparations of Tadalafil |
| Molecular Formula | C22H17N3O5 |
| CAS# | 1346602-17-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(CN1C)N2[C@H](C3=CC=C(O4)C(OC4=O)=C3)C(NC5=CC=CC=C65)=C6C[C@]2([H])C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05922.html |
| Additional Information | NULL |