Dapsone D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06529 |
| Alternative Name(s) | 4,4'-sulfonyldianiline D4;DADPS-d4, DDS-d4, Avlosulfon-d4, Croysulfone-d4, Diphenasone-d4, Disulone-d4, Dumitone-d4, Eporal-d4, Novophone-d4, Sulfona-Mae-d4, Sulphadione-d4, 4,4’-Sulfonylbisbenzeneamine-d4; 1,1’-Sulfonylbis[4-aminobenzene]-d4; 4,4’-Diaminodiphenyl Sulfone-d4; NSC 6091-d4; |
| Research Area | Intended for use as an internal standard for the quantification of Dapsone by GC- or LC-mass spectrometry |
| Molecular Formula | C12H8D4N2O2S |
| CAS# | 1346602-12-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](C(C([2H])=C1[2H])=C(C([2H])=C1N)[2H])(C2=CC=C(N)C=C2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06529.html |
| Additional Information | NULL |