3-Carene
3-Carene (Carene, Delta-3-Carene) is a bicyclic monoterpene in essential oils extracted from pine trees. 3-Carene have potent pharmacological effects on COX-2 overexpression and LPS-induced migration of Raw264.7 macrophages. 3‐carene is shown to significantly stimulate the activity and expression of alkaline phosphatase, an early phase marker of osteoblastic differentiation.
| Trivial name | Carene, Delta-3-Carene |
| Catalog Number | S5595 |
| Molecular Formula | C38H50N6O5 |
| CAS# | 13466-78-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)(C)NC(=O)C1CC2CCCCC2CN1CC(O)C(CC3=CC=CC=C3)NC(=O)C(CC(N)=O)NC(=O)C4=NC5=CC=CC=C5C=C4 |
| Size | 25ul |
| Supplier Page | http://www.selleckchem.com/products/3-carene.html |
| Additional Information | https://file.selleck.cn/downloads/struct/carene-chemical-structure-s5595.gif |