ML241
p97 ATPase inhibitor Ubiquitination/ Proteasome|p97
| Catalog Number | B6107-50 |
| Research Area | Ubiquitination/ Proteasome|p97 |
| Molecular Formula | C23H24N4O |
| CAS# | 1346528-06-0 |
| Purity | 98% |
| SMILES | C1(CNC2=NC(N3CCOC4=CC=CC=C43)=NC5=C2CCCC5)=CC=CC=C1 |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6107 |
