L-Carnipure tartrate
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-30969 |
| Alternative Name(s) | magnesium(2+)ion(3R)-3-hydroxy-4- (trimethylazaniumyl)butanoatxypentanedioate |
| Research Area | L-Carnitine magnesium citrate combines the benefits of L-Carnitine and magnesium in an ideal ratio. |
| Molecular Formula | C13H21MgNO10 |
| CAS# | 134620-06-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [O-]C(CC1(CC2=O)[OH][Mg+2]([OH]C(C3)C[N+](C)(C)C)([O-]2)([O-]C3=O)[O-]C1=O)=O.[H+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30969.html |
| Additional Information | NULL |
