Thromboxane B2-d4 | MedChemExpress (MCE)
Thromboxane B2-D4 is the deuterium labeled Thromboxane B2. Thromboxane B2 is a prostaglandin derivative that is released during anaphylaxis. Thromboxane B2 induces arterial contraction and platelet aggregation[1][2].
Trivial name | Thromboxane B2-d4 |
Catalog Number | HY-113331S |
Research Area | Inflammation/Immunology |
CAS# | 1346112-79-5 |
Purity | ≥98.0% |
SMILES | O=C(O)CC([2H])([2H])C([2H])([2H])/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)O[C@@H](O)C[C@@H]1O |
Size | 5 mg |
Supplier Page | https://www.medchemexpress.com/thromboxane-b2-d4.html |