AM095 5mg
AM095 is a potent LPA1 receptor antagonist because it inhibited GTP??S binding to Chinese hamster ovary (CHO) cell membranes overexpressing recombinant human or mouse LPA1 with IC50 values of 0.98 and 0.73 ??M, respectively, and exhibited no LPA1 agonism.
| Trivial name | AM095 5mg |
| Catalog Number | A13981-5 |
| Alternative Name(s) | sodium (R)-2-(4'-(3-methyl-4-(((1-phenylethoxy)carbonyl)amino)isoxazol-5-yl)-[1,1'-biphenyl]-4-yl)acetate |
| Molecular Formula | C27H23N2NaO5 |
| CAS# | 1345614-59-6 |
| SMILES | CC1=NOC(=C1NC(=O)O[C@H](C)C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)CC(=O)[O-].[Na+] |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/am095-12014.html |
