RKI-1447 10mM * 1mL in DMSO
RKI-1447 is a potent inhibitor of the Rho-associated ROCK kinases with anti-invasive and antitumor activities in breast cancer.
| Trivial name | RKI-1447 10mM * 1mL in DMSO |
| Catalog Number | A13067-10mM-D |
| Alternative Name(s) | 1-(3-Hydroxybenzyl)-3-(4-(pyridin-4-yl)thiazol-2-yl)urea |
| Molecular Formula | C16H14N4O2S |
| CAS# | 1342278-01-6 |
| SMILES | C1=CC(=CC(=C1)O)CNC(=O)NC2=NC(=CS2)C3=CC=NC=C3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/rki-1447.html |
