Hydroxocobalamin
Drug Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-79488 |
| Alternative Name(s) | Alpha Cobione; AlphaRedisol; Axlon; Ciplamin H; Hydroxo-cobalamin; Cobalex; Cobalin H; Cobinamide hydroxide phosphate 3’-ester with 5,6-dimethyl-1-α-D-ribofuranosylbenzimidazole Inner Salt; Codroxomin; Docclan; Docelan; Docevita; Droxomin; Ducobee Hy; Dur袈袈袈袈 |
| Research Area | Hydroxocobalamin is an intermediate in the synthesis of Nitritocobalamin is a useful synthetic intermediate in the synthesis of Hydroxocobalamin Acetate; a physiological analog of vitamin B12 where the CN group is replaced with OH. Exists in aqueous solution as an equilibrium mixture of the hydroxy isomer and the ionic aqua isomer (aquacobalamin). Precursor of the coenzymes methylcobalamin and cobamamide. Coordination Compound. Vitamin (hematopoietic). |
| Molecular Formula | C₆₂H₈₉CoN₁₃O₁₅P |
| CAS# | 13422-51-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@H](OP([O-])(O[C@H]1[C@H]([C@@H](N2C=NC3=CC(C)=C(C=C23)C)O[C@@H]1CO)O)=O)CNC(CC[C@@]4([C@H](C5[N-2]/C4=C(C6=N/C(C(C)([C@@H]6CCC(N)=O)C)=CC7=N/C([C@@](CC(N)=O)([C@@H]7CCC(N)=O)C)=C(C8=N[C@@]5([C@@](CC(N)=O)([C@@H]8CCC(N)=O)C)C)/C)/C)CC(N)=O)C)=O.[OH2-] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST79488.html |
| Additional Information | NULL |