β-Glucogallin | MedChemExpress (MCE)
β-Glucogallin is a potent and selective aldose reductase (AKR1B1) inhibitor. β-Glucogallin can be isolated from the medicinal plant Emblica officinalis[1].
| Trivial name | β-Glucogallin |
| Catalog Number | HY-133708 |
| Alternative Name(s) | 1-O-Galloyl-β-D-glucose |
| Research Area | Metabolic Disease |
| CAS# | 13405-60-2 |
| Purity | ≥98.00% |
| SMILES | O[C@H]1[C@H](OC(C2=CC(O)=C(O)C(O)=C2)=O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| PubChem Chemical Structure ID | 124021 |
| Size | 25 mg |
| Supplier Page | https://www.medchemexpress.com/β-glucogallin.html |