BMS-5
BMS-5 is a highly selective and potent inhibitor of both LIMK 1 and 2 with IC50 values of 7 and 8 nM, respectively.
| Trivial name | LIMKi 3 |
| Catalog Number | CSN17706 |
| Alternative Name(s) | LIMKi 3 |
| Research Area | Immunology/Inflammation|Neurological Disease |
| Molecular Formula | C17H14Cl2F2N4OS |
| CAS# | 1338247-35-0 |
| Purity | ≥99% |
| SMILES | CC(C)C(NC1=NC=C(C2=CC(C(F)F)=NN2C3=C(Cl)C=CC=C3Cl)S1)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/bms-5.html |
